About hydrazine;2-propan-2-yl-1H-imidazole
hydrazine;2-propan-2-yl-1H-imidazole (PubChem CID 158955026) has the molecular formula C6H14N4
and a molecular weight of 142.21 g/mol. Its IUPAC name is hydrazine;2-propan-2-yl-1H-imidazole.
Molecular Properties
| Compound Name | hydrazine;2-propan-2-yl-1H-imidazole |
| PubChem CID | 158955026 |
| Molecular Formula | C6H14N4 |
| Molecular Weight | 142.21 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | hydrazine;2-propan-2-yl-1H-imidazole |
| SMILES | CC(C)c1ncc[nH]1.NN |
| InChI | InChI=1S/C6H10N2.H4N2/c1-5(2)6-7-3-4-8-6;1-2/h3-5H,1-2H3,(H,7,8);1-2H2 |
| InChIKey | JLWYLZZIUASRAX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;2-propan-2-yl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;2-propan-2-yl-1H-imidazole?
The IUPAC name of hydrazine;2-propan-2-yl-1H-imidazole (CID 158955026) is hydrazine;2-propan-2-yl-1H-imidazole.
What is the SMILES notation for hydrazine;2-propan-2-yl-1H-imidazole?
The canonical SMILES for hydrazine;2-propan-2-yl-1H-imidazole is CC(C)c1ncc[nH]1.NN.
What is the InChIKey of hydrazine;2-propan-2-yl-1H-imidazole?
The InChIKey is JLWYLZZIUASRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.H4N2/c1-5(2)6-7-3-4-8-6;1-2/h3-5H,1-2H3,(H,7,8);1-2H2.
What are the key properties of hydrazine;2-propan-2-yl-1H-imidazole?
hydrazine;2-propan-2-yl-1H-imidazole has a molecular weight of 142.21 g/mol, XLogP of 0.35, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;2-propan-2-yl-1H-imidazole is sourced from PubChem (CID 158955026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).