C12H24N4O2S — CID 106029941
4-(ethylaminomethyl)-5-methyl-N-(3-methylbutan-2-yl)-1H-pyrazole-3-sulfonamide (PubChem CID 106029941) has the molecular formula C12H24N4O2S and a molecular weight of 288.42 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-5-methyl-N-(3-methylbutan-2-yl)-1H-pyrazole-3-sulfonamide.
| Compound Name | 4-(ethylaminomethyl)-5-methyl-N-(3-methylbutan-2-yl)-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 106029941 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-(ethylaminomethyl)-5-methyl-N-(3-methylbutan-2-yl)-1H-pyrazole-3-sulfonamide |
| SMILES | CCNCc1c(S(=O)(=O)NC(C)C(C)C)n[nH]c1C |
| InChI | InChI=1S/C12H24N4O2S/c1-6-13-7-11-10(5)14-15-12(11)19(17,18)16-9(4)8(2)3/h8-9,13,16H,6-7H2,1-5H3,(H,14,15) |
| InChIKey | WYXJGEGZOHGCKT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |