C11H14F2N2O — CID 102729336
4-[(3,5-difluoro-2-pyridinyl)oxy]cyclohexan-1-amine (PubChem CID 102729336) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is 4-[(3,5-difluoro-2-pyridinyl)oxy]cyclohexan-1-amine.
| Compound Name | 4-[(3,5-difluoro-2-pyridinyl)oxy]cyclohexan-1-amine |
|---|---|
| PubChem CID | 102729336 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-[(3,5-difluoro-2-pyridinyl)oxy]cyclohexan-1-amine |
| SMILES | NC1CCC(Oc2ncc(F)cc2F)CC1 |
| InChI | InChI=1S/C11H14F2N2O/c12-7-5-10(13)11(15-6-7)16-9-3-1-8(14)2-4-9/h5-6,8-9H,1-4,14H2 |
| InChIKey | BDCOUXHYTIACHG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |