C9H10F2N2O — CID 67479860
3,5-difluoro-2-pyrrolidin-3-yloxypyridine (PubChem CID 67479860) has the molecular formula C9H10F2N2O and a molecular weight of 200.19 g/mol. Its IUPAC name is 3,5-difluoro-2-pyrrolidin-3-yloxypyridine.
| Compound Name | 3,5-difluoro-2-pyrrolidin-3-yloxypyridine |
|---|---|
| PubChem CID | 67479860 |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 3,5-difluoro-2-pyrrolidin-3-yloxypyridine |
| SMILES | Fc1cnc(OC2CCNC2)c(F)c1 |
| InChI | InChI=1S/C9H10F2N2O/c10-6-3-8(11)9(13-4-6)14-7-1-2-12-5-7/h3-4,7,12H,1-2,5H2 |
| InChIKey | RHXXTRTUXQTMKT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |