About 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride
6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride (PubChem CID 166104225) has the molecular formula C11H13ClF2N2O
and a molecular weight of 262.69 g/mol. Its IUPAC name is 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride.
Molecular Properties
| Compound Name | 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride |
| PubChem CID | 166104225 |
| Molecular Formula | C11H13ClF2N2O |
| Molecular Weight | 262.69 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride |
| SMILES | Cl.Fc1cnc(OCC2C3CNCC32)c(F)c1 |
| InChI | InChI=1S/C11H12F2N2O.ClH/c12-6-1-10(13)11(15-2-6)16-5-9-7-3-14-4-8(7)9;/h1-2,7-9,14H,3-5H2;1H |
| InChIKey | CGSNWBWZLUNVSX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.69 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride?
The IUPAC name of 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride (CID 166104225) is 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride.
What is the SMILES notation for 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride?
The canonical SMILES for 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride is Cl.Fc1cnc(OCC2C3CNCC32)c(F)c1.
What is the InChIKey of 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride?
The InChIKey is CGSNWBWZLUNVSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2N2O.ClH/c12-6-1-10(13)11(15-2-6)16-5-9-7-3-14-4-8(7)9;/h1-2,7-9,14H,3-5H2;1H.
What are the key properties of 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride?
6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride has a molecular weight of 262.69 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,5-difluoro-2-pyridinyl)oxymethyl]-3-azabicyclo[3.1.0]hexane;hydrochloride is sourced from PubChem (CID 166104225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).