C17H30N4O2 — CID 102730358
tert-butyl N-[4-amino-3-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]butan-2-yl]carbamate (PubChem CID 102730358) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 102730358 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | tert-butyl N-[4-amino-3-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]butan-2-yl]carbamate |
| SMILES | Cc1cccc(CN(C)C(CN)C(C)NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C17H30N4O2/c1-12-8-7-9-14(19-12)11-21(6)15(10-18)13(2)20-16(22)23-17(3,4)5/h7-9,13,15H,10-11,18H2,1-6H3,(H,20,22) |
| InChIKey | BZIRPMPAAQQAHF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |