C14H25N3O2 — CID 102730820
tert-butyl N-(3-cyano-3-piperidin-1-ylpropyl)carbamate (PubChem CID 102730820) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl N-(3-cyano-3-piperidin-1-ylpropyl)carbamate.
| Compound Name | tert-butyl N-(3-cyano-3-piperidin-1-ylpropyl)carbamate |
|---|---|
| PubChem CID | 102730820 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | tert-butyl N-(3-cyano-3-piperidin-1-ylpropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(C#N)N1CCCCC1 |
| InChI | InChI=1S/C14H25N3O2/c1-14(2,3)19-13(18)16-8-7-12(11-15)17-9-5-4-6-10-17/h12H,4-10H2,1-3H3,(H,16,18) |
| InChIKey | RISVWHWRWFADFH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |