C20H27Cl2N3O2 — CID 10273089
2-[4-(3,5-dichlorophenoxy)-3,5-diethylpyrazol-1-yl]-N-(oxolan-2-ylmethyl)ethanamine (PubChem CID 10273089) has the molecular formula C20H27Cl2N3O2 and a molecular weight of 412.36 g/mol. Its IUPAC name is 2-[4-(3,5-dichlorophenoxy)-3,5-diethylpyrazol-1-yl]-N-(oxolan-2-ylmethyl)ethanamine.
| Compound Name | 2-[4-(3,5-dichlorophenoxy)-3,5-diethylpyrazol-1-yl]-N-(oxolan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 10273089 |
| Molecular Formula | C20H27Cl2N3O2 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[4-(3,5-dichlorophenoxy)-3,5-diethylpyrazol-1-yl]-N-(oxolan-2-ylmethyl)ethanamine |
| SMILES | CCc1nn(CCNCC2CCCO2)c(CC)c1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H27Cl2N3O2/c1-3-18-20(27-17-11-14(21)10-15(22)12-17)19(4-2)25(24-18)8-7-23-13-16-6-5-9-26-16/h10-12,16,23H,3-9,13H2,1-2H3 |
| InChIKey | HDHUGHJHTZNDHI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|