C12H21N3O — CID 82702523
3,5-diethyl-1-(oxolan-2-ylmethyl)pyrazol-4-amine (PubChem CID 82702523) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 3,5-diethyl-1-(oxolan-2-ylmethyl)pyrazol-4-amine.
| Compound Name | 3,5-diethyl-1-(oxolan-2-ylmethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 82702523 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 3,5-diethyl-1-(oxolan-2-ylmethyl)pyrazol-4-amine |
| SMILES | CCc1nn(CC2CCCO2)c(CC)c1N |
| InChI | InChI=1S/C12H21N3O/c1-3-10-12(13)11(4-2)15(14-10)8-9-6-5-7-16-9/h9H,3-8,13H2,1-2H3 |
| InChIKey | CVFSZFSSXRNBAZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |