C12H23NO — CID 102731666
trans-(1R,2R)-2-(2-cyclopropylpropylamino)cyclohexan-1-ol (PubChem CID 102731666) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2-cyclopropylpropylamino)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(2-cyclopropylpropylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731666 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | trans-(1R,2R)-2-(2-cyclopropylpropylamino)cyclohexan-1-ol |
| SMILES | CC(CN[C@@H]1CCCC[C@H]1O)C1CC1 |
| InChI | InChI=1S/C12H23NO/c1-9(10-6-7-10)8-13-11-4-2-3-5-12(11)14/h9-14H,2-8H2,1H3/t9?,11-,12-/m1/s1 |
| InChIKey | ONGJIPAGUZPJIN-JZXPMDSESA-N |
| XLogP | 1.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |