C10H21NO2S — CID 102731693
trans-(1S,2S)-2-(2-methylsulfinylpropylamino)cyclohexan-1-ol (PubChem CID 102731693) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2-methylsulfinylpropylamino)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(2-methylsulfinylpropylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731693 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | trans-(1S,2S)-2-(2-methylsulfinylpropylamino)cyclohexan-1-ol |
| SMILES | CC(CN[C@H]1CCCC[C@@H]1O)S(C)=O |
| InChI | InChI=1S/C10H21NO2S/c1-8(14(2)13)7-11-9-5-3-4-6-10(9)12/h8-12H,3-7H2,1-2H3/t8?,9-,10-,14?/m0/s1 |
| InChIKey | DHUQDVQCWBPFAS-USQDWFKJSA-N |
| XLogP | 0.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |