About 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile
3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile (PubChem CID 102731792) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile.
Molecular Properties
| Compound Name | 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile |
| PubChem CID | 102731792 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile |
| SMILES | CN(CCC#N)[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C10H18N2O/c1-12(8-4-7-11)9-5-2-3-6-10(9)13/h9-10,13H,2-6,8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | RVDLEYFYVJGPID-UWVGGRQHSA-N |
| XLogP | 1.14 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile?
The IUPAC name of 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile (CID 102731792) is 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile.
What is the SMILES notation for 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile?
The canonical SMILES for 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile is CN(CCC#N)[C@H]1CCCC[C@@H]1O.
What is the InChIKey of 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile?
The InChIKey is RVDLEYFYVJGPID-UWVGGRQHSA-N. The full InChI is InChI=1S/C10H18N2O/c1-12(8-4-7-11)9-5-2-3-6-10(9)13/h9-10,13H,2-6,8H2,1H3/t9-,10-/m0/s1.
What are the key properties of 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile?
3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile has a molecular weight of 182.27 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1S,2S)-2-hydroxycyclohexyl]-methylamino]propanenitrile is sourced from PubChem (CID 102731792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).