C5H2Br4O2 — CID 10273182
4,5-dibromo-5-(dibromomethyl)furan-2-one (PubChem CID 10273182) has the molecular formula C5H2Br4O2 and a molecular weight of 413.69 g/mol. Its IUPAC name is 4,5-dibromo-5-(dibromomethyl)furan-2-one.
| Compound Name | 4,5-dibromo-5-(dibromomethyl)furan-2-one |
|---|---|
| PubChem CID | 10273182 |
| Molecular Formula | C5H2Br4O2 |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 409.68 |
| IUPAC Name | 4,5-dibromo-5-(dibromomethyl)furan-2-one |
| SMILES | O=C1C=C(Br)C(Br)(C(Br)Br)O1 |
| InChI | InChI=1S/C5H2Br4O2/c6-2-1-3(10)11-5(2,9)4(7)8/h1,4H |
| InChIKey | DZMLLYUUWBEQCA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|