C5H3Br3O2 — CID 11759452
3,5-dibromo-5-(bromomethyl)furan-2-one (PubChem CID 11759452) has the molecular formula C5H3Br3O2 and a molecular weight of 334.79 g/mol. Its IUPAC name is 3,5-dibromo-5-(bromomethyl)furan-2-one.
| Compound Name | 3,5-dibromo-5-(bromomethyl)furan-2-one |
|---|---|
| PubChem CID | 11759452 |
| Molecular Formula | C5H3Br3O2 |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 331.77 |
| IUPAC Name | 3,5-dibromo-5-(bromomethyl)furan-2-one |
| SMILES | O=C1OC(Br)(CBr)C=C1Br |
| InChI | InChI=1S/C5H3Br3O2/c6-2-5(8)1-3(7)4(9)10-5/h1H,2H2 |
| InChIKey | OXJHNCZYDUENOJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|