C12H23NO2 — CID 102731928
trans-(1S,2S)-2-(3-ethylmorpholin-4-yl)cyclohexan-1-ol (PubChem CID 102731928) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3-ethylmorpholin-4-yl)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(3-ethylmorpholin-4-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731928 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | trans-(1S,2S)-2-(3-ethylmorpholin-4-yl)cyclohexan-1-ol |
| SMILES | CCC1COCCN1[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C12H23NO2/c1-2-10-9-15-8-7-13(10)11-5-3-4-6-12(11)14/h10-12,14H,2-9H2,1H3/t10?,11-,12-/m0/s1 |
| InChIKey | HKRWWZPSMGVOOZ-RAMGSTBQSA-N |
| XLogP | 1.40 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |