C15H30N2O — CID 114087668
2-(2-ethyl-4-methyl-1,4-diazepan-1-yl)cycloheptan-1-ol (PubChem CID 114087668) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 2-(2-ethyl-4-methyl-1,4-diazepan-1-yl)cycloheptan-1-ol.
| Compound Name | 2-(2-ethyl-4-methyl-1,4-diazepan-1-yl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 114087668 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 2-(2-ethyl-4-methyl-1,4-diazepan-1-yl)cycloheptan-1-ol |
| SMILES | CCC1CN(C)CCCN1C1CCCCCC1O |
| InChI | InChI=1S/C15H30N2O/c1-3-13-12-16(2)10-7-11-17(13)14-8-5-4-6-9-15(14)18/h13-15,18H,3-12H2,1-2H3 |
| InChIKey | CRBYQQPCCVQOKU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |