C13H25NO2 — CID 102732019
trans-(1S,2S)-2-(3-ethoxypiperidin-1-yl)cyclohexan-1-ol (PubChem CID 102732019) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3-ethoxypiperidin-1-yl)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(3-ethoxypiperidin-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102732019 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | trans-(1S,2S)-2-(3-ethoxypiperidin-1-yl)cyclohexan-1-ol |
| SMILES | CCOC1CCCN([C@H]2CCCC[C@@H]2O)C1 |
| InChI | InChI=1S/C13H25NO2/c1-2-16-11-6-5-9-14(10-11)12-7-3-4-8-13(12)15/h11-13,15H,2-10H2,1H3/t11?,12-,13-/m0/s1 |
| InChIKey | NPOFHYPKDPPVGQ-SPOOISQMSA-N |
| XLogP | 1.79 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |