C13H15N3O3 — CID 102732364
trans-(1R,2R)-2-(6-nitroindazol-1-yl)cyclohexan-1-ol (PubChem CID 102732364) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is trans-(1R,2R)-2-(6-nitroindazol-1-yl)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(6-nitroindazol-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102732364 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | trans-(1R,2R)-2-(6-nitroindazol-1-yl)cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1ccc2cnn([C@@H]3CCCC[C@H]3O)c2c1 |
| InChI | InChI=1S/C13H15N3O3/c17-13-4-2-1-3-11(13)15-12-7-10(16(18)19)6-5-9(12)8-14-15/h5-8,11,13,17H,1-4H2/t11-,13-/m1/s1 |
| InChIKey | APHPSTGCXHRUSR-DGCLKSJQSA-N |
| XLogP | 2.42 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|