About methane;methyl 6-nitroindazole-1-carboxylate
methane;methyl 6-nitroindazole-1-carboxylate (PubChem CID 174489049) has the molecular formula C10H11N3O4
and a molecular weight of 237.22 g/mol. Its IUPAC name is methane;methyl 6-nitroindazole-1-carboxylate.
Molecular Properties
| Compound Name | methane;methyl 6-nitroindazole-1-carboxylate |
| PubChem CID | 174489049 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | methane;methyl 6-nitroindazole-1-carboxylate |
| SMILES | C.COC(=O)n1ncc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C9H7N3O4.CH4/c1-16-9(13)11-8-4-7(12(14)15)3-2-6(8)5-10-11;/h2-5H,1H3;1H4 |
| InChIKey | NFIZVPKDCWJXGS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;methyl 6-nitroindazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl 6-nitroindazole-1-carboxylate?
The IUPAC name of methane;methyl 6-nitroindazole-1-carboxylate (CID 174489049) is methane;methyl 6-nitroindazole-1-carboxylate.
What is the SMILES notation for methane;methyl 6-nitroindazole-1-carboxylate?
The canonical SMILES for methane;methyl 6-nitroindazole-1-carboxylate is C.COC(=O)n1ncc2ccc([N+](=O)[O-])cc21.
What is the InChIKey of methane;methyl 6-nitroindazole-1-carboxylate?
The InChIKey is NFIZVPKDCWJXGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O4.CH4/c1-16-9(13)11-8-4-7(12(14)15)3-2-6(8)5-10-11;/h2-5H,1H3;1H4.
What are the key properties of methane;methyl 6-nitroindazole-1-carboxylate?
methane;methyl 6-nitroindazole-1-carboxylate has a molecular weight of 237.22 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl 6-nitroindazole-1-carboxylate is sourced from PubChem (CID 174489049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).