C9H13ClN2O — CID 102732380
trans-(1S,2S)-2-(4-chloropyrazol-1-yl)cyclohexan-1-ol (PubChem CID 102732380) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is trans-(1S,2S)-2-(4-chloropyrazol-1-yl)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(4-chloropyrazol-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102732380 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | trans-(1S,2S)-2-(4-chloropyrazol-1-yl)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1n1cc(Cl)cn1 |
| InChI | InChI=1S/C9H13ClN2O/c10-7-5-11-12(6-7)8-3-1-2-4-9(8)13/h5-6,8-9,13H,1-4H2/t8-,9-/m0/s1 |
| InChIKey | HUSKQOMRXWIBPN-IUCAKERBSA-N |
| XLogP | 2.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |