C10H14N2O3 — CID 94560602
1-[(1R,2R)-2-hydroxycyclohexyl]pyrazole-4-carboxylic acid (PubChem CID 94560602) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 1-[(1R,2R)-2-hydroxycyclohexyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[(1R,2R)-2-hydroxycyclohexyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94560602 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-[(1R,2R)-2-hydroxycyclohexyl]pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn([C@@H]2CCCC[C@H]2O)c1 |
| InChI | InChI=1S/C10H14N2O3/c13-9-4-2-1-3-8(9)12-6-7(5-11-12)10(14)15/h5-6,8-9,13H,1-4H2,(H,14,15)/t8-,9-/m1/s1 |
| InChIKey | ZKSQQZWDLKIUSO-RKDXNWHRSA-N |
| XLogP | 1.06 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |