C9H19NO2 — CID 102733128
trans-(1R,2R)-2-(2-ethoxyethylamino)cyclopentan-1-ol (PubChem CID 102733128) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2-ethoxyethylamino)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(2-ethoxyethylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102733128 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | trans-(1R,2R)-2-(2-ethoxyethylamino)cyclopentan-1-ol |
| SMILES | CCOCCN[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C9H19NO2/c1-2-12-7-6-10-8-4-3-5-9(8)11/h8-11H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | RYBXKBDXCUDEDK-RKDXNWHRSA-N |
| XLogP | 0.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|