C10H17NO — CID 102733511
trans-(1S,2S)-2-(2-methylbut-3-yn-2-ylamino)cyclopentan-1-ol (PubChem CID 102733511) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2-methylbut-3-yn-2-ylamino)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(2-methylbut-3-yn-2-ylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102733511 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | trans-(1S,2S)-2-(2-methylbut-3-yn-2-ylamino)cyclopentan-1-ol |
| SMILES | C#CC(C)(C)N[C@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C10H17NO/c1-4-10(2,3)11-8-6-5-7-9(8)12/h1,8-9,11-12H,5-7H2,2-3H3/t8-,9-/m0/s1 |
| InChIKey | IYVXLXXXOBIKDM-IUCAKERBSA-N |
| XLogP | 0.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|