C12H24N2O2 — CID 102733998
N-tert-butyl-2-[[(1S,2S)-2-hydroxycyclopentyl]amino]propanamide (PubChem CID 102733998) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-tert-butyl-2-[[(1S,2S)-2-hydroxycyclopentyl]amino]propanamide.
| Compound Name | N-tert-butyl-2-[[(1S,2S)-2-hydroxycyclopentyl]amino]propanamide |
|---|---|
| PubChem CID | 102733998 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-tert-butyl-2-[[(1S,2S)-2-hydroxycyclopentyl]amino]propanamide |
| SMILES | CC(N[C@H]1CCC[C@@H]1O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-8(11(16)14-12(2,3)4)13-9-6-5-7-10(9)15/h8-10,13,15H,5-7H2,1-4H3,(H,14,16)/t8?,9-,10-/m0/s1 |
| InChIKey | CUBSZVDKCZYZLB-AGROOBSYSA-N |
| XLogP | 0.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |