C10H19N3O3 — CID 62359652
N-carbamoyl-2-[(2-hydroxycyclohexyl)amino]propanamide (PubChem CID 62359652) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is N-carbamoyl-2-[(2-hydroxycyclohexyl)amino]propanamide.
| Compound Name | N-carbamoyl-2-[(2-hydroxycyclohexyl)amino]propanamide |
|---|---|
| PubChem CID | 62359652 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | N-carbamoyl-2-[(2-hydroxycyclohexyl)amino]propanamide |
| SMILES | CC(NC1CCCCC1O)C(=O)NC(N)=O |
| InChI | InChI=1S/C10H19N3O3/c1-6(9(15)13-10(11)16)12-7-4-2-3-5-8(7)14/h6-8,12,14H,2-5H2,1H3,(H3,11,13,15,16) |
| InChIKey | QMGDMNBGWTYXQL-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |