C9H15NO — CID 102734054
trans-(1R,2R)-2-(but-2-ynylamino)cyclopentan-1-ol (PubChem CID 102734054) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is trans-(1R,2R)-2-(but-2-ynylamino)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(but-2-ynylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102734054 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | trans-(1R,2R)-2-(but-2-ynylamino)cyclopentan-1-ol |
| SMILES | CC#CCN[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C9H15NO/c1-2-3-7-10-8-5-4-6-9(8)11/h8-11H,4-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | DKDGOXTYNCWBPO-RKDXNWHRSA-N |
| XLogP | 0.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|