C14H18N2O2 — CID 102735246
1-[(1S,2S)-2-hydroxycyclopentyl]-3-methyl-4H-quinazolin-2-one (PubChem CID 102735246) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-[(1S,2S)-2-hydroxycyclopentyl]-3-methyl-4H-quinazolin-2-one.
| Compound Name | 1-[(1S,2S)-2-hydroxycyclopentyl]-3-methyl-4H-quinazolin-2-one |
|---|---|
| PubChem CID | 102735246 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-[(1S,2S)-2-hydroxycyclopentyl]-3-methyl-4H-quinazolin-2-one |
| SMILES | CN1Cc2ccccc2N([C@H]2CCC[C@@H]2O)C1=O |
| InChI | InChI=1S/C14H18N2O2/c1-15-9-10-5-2-3-6-11(10)16(14(15)18)12-7-4-8-13(12)17/h2-3,5-6,12-13,17H,4,7-9H2,1H3/t12-,13-/m0/s1 |
| InChIKey | FYOTYTDCSJJZGM-STQMWFEESA-N |
| XLogP | 1.97 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |