C14H19BrFN3O — CID 102735929
N-[[1-(2-amino-4-bromo-5-fluorophenyl)piperidin-4-yl]methyl]acetamide (PubChem CID 102735929) has the molecular formula C14H19BrFN3O and a molecular weight of 344.23 g/mol. Its IUPAC name is N-[[1-(2-amino-4-bromo-5-fluorophenyl)piperidin-4-yl]methyl]acetamide.
| Compound Name | N-[[1-(2-amino-4-bromo-5-fluorophenyl)piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 102735929 |
| Molecular Formula | C14H19BrFN3O |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[[1-(2-amino-4-bromo-5-fluorophenyl)piperidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCN(c2cc(F)c(Br)cc2N)CC1 |
| InChI | InChI=1S/C14H19BrFN3O/c1-9(20)18-8-10-2-4-19(5-3-10)14-7-12(16)11(15)6-13(14)17/h6-7,10H,2-5,8,17H2,1H3,(H,18,20) |
| InChIKey | BCNSIOHJUPRCGO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|