C15H21BrFN3O — CID 107532516
N-[[1-[4-(aminomethyl)-3-bromo-2-fluorophenyl]piperidin-4-yl]methyl]acetamide (PubChem CID 107532516) has the molecular formula C15H21BrFN3O and a molecular weight of 358.26 g/mol. Its IUPAC name is N-[[1-[4-(aminomethyl)-3-bromo-2-fluorophenyl]piperidin-4-yl]methyl]acetamide.
| Compound Name | N-[[1-[4-(aminomethyl)-3-bromo-2-fluorophenyl]piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 107532516 |
| Molecular Formula | C15H21BrFN3O |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-[[1-[4-(aminomethyl)-3-bromo-2-fluorophenyl]piperidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCN(c2ccc(CN)c(Br)c2F)CC1 |
| InChI | InChI=1S/C15H21BrFN3O/c1-10(21)19-9-11-4-6-20(7-5-11)13-3-2-12(8-18)14(16)15(13)17/h2-3,11H,4-9,18H2,1H3,(H,19,21) |
| InChIKey | HSUWHLBKBBWWNO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |