C14H20BrFN2O — CID 107532524
[2-bromo-3-fluoro-4-(3-methoxy-4-methylpiperidin-1-yl)phenyl]methanamine (PubChem CID 107532524) has the molecular formula C14H20BrFN2O and a molecular weight of 331.23 g/mol. Its IUPAC name is [2-bromo-3-fluoro-4-(3-methoxy-4-methylpiperidin-1-yl)phenyl]methanamine.
| Compound Name | [2-bromo-3-fluoro-4-(3-methoxy-4-methylpiperidin-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 107532524 |
| Molecular Formula | C14H20BrFN2O |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | [2-bromo-3-fluoro-4-(3-methoxy-4-methylpiperidin-1-yl)phenyl]methanamine |
| SMILES | COC1CN(c2ccc(CN)c(Br)c2F)CCC1C |
| InChI | InChI=1S/C14H20BrFN2O/c1-9-5-6-18(8-12(9)19-2)11-4-3-10(7-17)13(15)14(11)16/h3-4,9,12H,5-8,17H2,1-2H3 |
| InChIKey | WVYRFUFBIHZIOB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |