C12H14ClN3O4 — CID 102737716
2-chloro-N-[(3-hydroxycyclobutyl)methyl]-N-methyl-5-nitropyridine-4-carboxamide (PubChem CID 102737716) has the molecular formula C12H14ClN3O4 and a molecular weight of 299.71 g/mol. Its IUPAC name is 2-chloro-N-[(3-hydroxycyclobutyl)methyl]-N-methyl-5-nitropyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[(3-hydroxycyclobutyl)methyl]-N-methyl-5-nitropyridine-4-carboxamide |
|---|---|
| PubChem CID | 102737716 |
| Molecular Formula | C12H14ClN3O4 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-chloro-N-[(3-hydroxycyclobutyl)methyl]-N-methyl-5-nitropyridine-4-carboxamide |
| SMILES | CN(CC1CC(O)C1)C(=O)c1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14ClN3O4/c1-15(6-7-2-8(17)3-7)12(18)9-4-11(13)14-5-10(9)16(19)20/h4-5,7-8,17H,2-3,6H2,1H3 |
| InChIKey | JZWXSCQXLOVVDX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|