C12H12ClN3O3 — CID 103730747
2-chloro-5-nitro-N,N-bis(prop-2-enyl)pyridine-4-carboxamide (PubChem CID 103730747) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is 2-chloro-5-nitro-N,N-bis(prop-2-enyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-5-nitro-N,N-bis(prop-2-enyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103730747 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-chloro-5-nitro-N,N-bis(prop-2-enyl)pyridine-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12ClN3O3/c1-3-5-15(6-4-2)12(17)9-7-11(13)14-8-10(9)16(18)19/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | DJDUWJMQVRFOPB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|