C13H13ClN2O3 — CID 82781671
3-chloro-4-nitro-N,N-bis(prop-2-enyl)benzamide (PubChem CID 82781671) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is 3-chloro-4-nitro-N,N-bis(prop-2-enyl)benzamide.
| Compound Name | 3-chloro-4-nitro-N,N-bis(prop-2-enyl)benzamide |
|---|---|
| PubChem CID | 82781671 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 3-chloro-4-nitro-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C13H13ClN2O3/c1-3-7-15(8-4-2)13(17)10-5-6-12(16(18)19)11(14)9-10/h3-6,9H,1-2,7-8H2 |
| InChIKey | IPYDDOUEOGYOBH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|