C11H15N5 — CID 102738669
3-[[(1R,2R)-2-aminocyclohexyl]amino]pyridazine-4-carbonitrile (PubChem CID 102738669) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-aminocyclohexyl]amino]pyridazine-4-carbonitrile.
| Compound Name | 3-[[(1R,2R)-2-aminocyclohexyl]amino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 102738669 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-[[(1R,2R)-2-aminocyclohexyl]amino]pyridazine-4-carbonitrile |
| SMILES | N#Cc1ccnnc1N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C11H15N5/c12-7-8-5-6-14-16-11(8)15-10-4-2-1-3-9(10)13/h5-6,9-10H,1-4,13H2,(H,15,16)/t9-,10-/m1/s1 |
| InChIKey | VOYFXLWWSMXRSQ-NXEZZACHSA-N |
| XLogP | 1.03 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |