C13H16BrN3 — CID 102738833
2-[[(1R,2R)-2-aminocyclohexyl]amino]-4-bromobenzonitrile (PubChem CID 102738833) has the molecular formula C13H16BrN3 and a molecular weight of 294.20 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4-bromobenzonitrile.
| Compound Name | 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4-bromobenzonitrile |
|---|---|
| PubChem CID | 102738833 |
| Molecular Formula | C13H16BrN3 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4-bromobenzonitrile |
| SMILES | N#Cc1ccc(Br)cc1N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C13H16BrN3/c14-10-6-5-9(8-15)13(7-10)17-12-4-2-1-3-11(12)16/h5-7,11-12,17H,1-4,16H2/t11-,12-/m1/s1 |
| InChIKey | KVXZLGUWPKTYJC-VXGBXAGGSA-N |
| XLogP | 3.00 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |