About 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile
2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile (PubChem CID 66703712) has the molecular formula C14H18ClN3
and a molecular weight of 263.77 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile.
Molecular Properties
| Compound Name | 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile |
| PubChem CID | 66703712 |
| Molecular Formula | C14H18ClN3 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile |
| SMILES | Cc1cc(C#N)c(N[C@H]2CCCC[C@@H]2N)cc1Cl |
| InChI | InChI=1S/C14H18ClN3/c1-9-6-10(8-16)14(7-11(9)15)18-13-5-3-2-4-12(13)17/h6-7,12-13,18H,2-5,17H2,1H3/t12-,13-/m0/s1 |
| InChIKey | NHPRELWFYDJBRE-STQMWFEESA-N |
| XLogP | 3.20 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile?
The IUPAC name of 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile (CID 66703712) is 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile.
What is the SMILES notation for 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile?
The canonical SMILES for 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile is Cc1cc(C#N)c(N[C@H]2CCCC[C@@H]2N)cc1Cl.
What is the InChIKey of 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile?
The InChIKey is NHPRELWFYDJBRE-STQMWFEESA-N. The full InChI is InChI=1S/C14H18ClN3/c1-9-6-10(8-16)14(7-11(9)15)18-13-5-3-2-4-12(13)17/h6-7,12-13,18H,2-5,17H2,1H3/t12-,13-/m0/s1.
What are the key properties of 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile?
2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile has a molecular weight of 263.77 g/mol, XLogP of 3.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1S,2S)-2-aminocyclohexyl]amino]-4-chloro-5-methylbenzonitrile is sourced from PubChem (CID 66703712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).