C14H15BrN2 — CID 112740196
2-[[(1R,6S)-2-bicyclo[4.1.0]heptanyl]amino]-4-bromobenzonitrile (PubChem CID 112740196) has the molecular formula C14H15BrN2 and a molecular weight of 291.19 g/mol. Its IUPAC name is 2-[[(1R,6S)-2-bicyclo[4.1.0]heptanyl]amino]-4-bromobenzonitrile.
| Compound Name | 2-[[(1R,6S)-2-bicyclo[4.1.0]heptanyl]amino]-4-bromobenzonitrile |
|---|---|
| PubChem CID | 112740196 |
| Molecular Formula | C14H15BrN2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-[[(1R,6S)-2-bicyclo[4.1.0]heptanyl]amino]-4-bromobenzonitrile |
| SMILES | N#Cc1ccc(Br)cc1NC1CCC[C@H]2C[C@@H]12 |
| InChI | InChI=1S/C14H15BrN2/c15-11-5-4-10(8-16)14(7-11)17-13-3-1-2-9-6-12(9)13/h4-5,7,9,12-13,17H,1-3,6H2/t9-,12+,13?/m0/s1 |
| InChIKey | JIIFAQKVHLQDQH-XAWKZAOJSA-N |
| XLogP | 3.92 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |