About 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide
2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide (PubChem CID 102738776) has the molecular formula C13H18ClN3O
and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide.
Molecular Properties
| Compound Name | 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide |
| PubChem CID | 102738776 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide |
| SMILES | NC(=O)c1cc(Cl)ccc1N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C13H18ClN3O/c14-8-5-6-11(9(7-8)13(16)18)17-12-4-2-1-3-10(12)15/h5-7,10,12,17H,1-4,15H2,(H2,16,18)/t10-,12-/m1/s1 |
| InChIKey | VEAILMWPMLWPPA-ZYHUDNBSSA-N |
| XLogP | 2.12 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide?
The IUPAC name of 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide (CID 102738776) is 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide.
What is the SMILES notation for 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide?
The canonical SMILES for 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide is NC(=O)c1cc(Cl)ccc1N[C@@H]1CCCC[C@H]1N.
What is the InChIKey of 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide?
The InChIKey is VEAILMWPMLWPPA-ZYHUDNBSSA-N. The full InChI is InChI=1S/C13H18ClN3O/c14-8-5-6-11(9(7-8)13(16)18)17-12-4-2-1-3-10(12)15/h5-7,10,12,17H,1-4,15H2,(H2,16,18)/t10-,12-/m1/s1.
What are the key properties of 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide?
2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide has a molecular weight of 267.76 g/mol, XLogP of 2.12, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chlorobenzamide is sourced from PubChem (CID 102738776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).