C13H19N3O3 — CID 102740382
methyl 5-amino-6-[2-[cyclopropyl(methyl)amino]ethoxy]pyridine-2-carboxylate (PubChem CID 102740382) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl 5-amino-6-[2-[cyclopropyl(methyl)amino]ethoxy]pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-[2-[cyclopropyl(methyl)amino]ethoxy]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 102740382 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | methyl 5-amino-6-[2-[cyclopropyl(methyl)amino]ethoxy]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N)c(OCCN(C)C2CC2)n1 |
| InChI | InChI=1S/C13H19N3O3/c1-16(9-3-4-9)7-8-19-12-10(14)5-6-11(15-12)13(17)18-2/h5-6,9H,3-4,7-8,14H2,1-2H3 |
| InChIKey | NXXMZNOBMALONF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |