C12H18N2O2 — CID 102740402
[2-[2-[cyclopropyl(methyl)amino]ethoxy]-4-pyridinyl]methanol (PubChem CID 102740402) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is [2-[2-[cyclopropyl(methyl)amino]ethoxy]-4-pyridinyl]methanol.
| Compound Name | [2-[2-[cyclopropyl(methyl)amino]ethoxy]-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 102740402 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | [2-[2-[cyclopropyl(methyl)amino]ethoxy]-4-pyridinyl]methanol |
| SMILES | CN(CCOc1cc(CO)ccn1)C1CC1 |
| InChI | InChI=1S/C12H18N2O2/c1-14(11-2-3-11)6-7-16-12-8-10(9-15)4-5-13-12/h4-5,8,11,15H,2-3,6-7,9H2,1H3 |
| InChIKey | SOIGLVHADBTUFQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |