C8H9F2NO2 — CID 82007049
[2-(2,2-difluoroethoxy)-4-pyridinyl]methanol (PubChem CID 82007049) has the molecular formula C8H9F2NO2 and a molecular weight of 189.16 g/mol. Its IUPAC name is [2-(2,2-difluoroethoxy)-4-pyridinyl]methanol.
| Compound Name | [2-(2,2-difluoroethoxy)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 82007049 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | [2-(2,2-difluoroethoxy)-4-pyridinyl]methanol |
| SMILES | OCc1ccnc(OCC(F)F)c1 |
| InChI | InChI=1S/C8H9F2NO2/c9-7(10)5-13-8-3-6(4-12)1-2-11-8/h1-3,7,12H,4-5H2 |
| InChIKey | ATEBXQDYSYFYJA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |