C10H14F2N2O — CID 82005773
1-[2-(2,2-difluoroethoxy)-4-pyridinyl]-N-methylethanamine (PubChem CID 82005773) has the molecular formula C10H14F2N2O and a molecular weight of 216.23 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethoxy)-4-pyridinyl]-N-methylethanamine.
| Compound Name | 1-[2-(2,2-difluoroethoxy)-4-pyridinyl]-N-methylethanamine |
|---|---|
| PubChem CID | 82005773 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 1-[2-(2,2-difluoroethoxy)-4-pyridinyl]-N-methylethanamine |
| SMILES | CNC(C)c1ccnc(OCC(F)F)c1 |
| InChI | InChI=1S/C10H14F2N2O/c1-7(13-2)8-3-4-14-10(5-8)15-6-9(11)12/h3-5,7,9,13H,6H2,1-2H3 |
| InChIKey | VSWUSYNLVOHZJS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |