C11H15F2NO — CID 165043952
2-(2,2-difluoroethoxy)-5-methyl-4-propan-2-ylpyridine (PubChem CID 165043952) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-5-methyl-4-propan-2-ylpyridine.
| Compound Name | 2-(2,2-difluoroethoxy)-5-methyl-4-propan-2-ylpyridine |
|---|---|
| PubChem CID | 165043952 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-5-methyl-4-propan-2-ylpyridine |
| SMILES | Cc1cnc(OCC(F)F)cc1C(C)C |
| InChI | InChI=1S/C11H15F2NO/c1-7(2)9-4-11(14-5-8(9)3)15-6-10(12)13/h4-5,7,10H,6H2,1-3H3 |
| InChIKey | OOWFGYURONOYJW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |