C10H14F3NO — CID 162359586
2-(2,2-difluoroethoxy)-5-fluoro-4-methylpyridine;ethane (PubChem CID 162359586) has the molecular formula C10H14F3NO and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-5-fluoro-4-methylpyridine;ethane.
| Compound Name | 2-(2,2-difluoroethoxy)-5-fluoro-4-methylpyridine;ethane |
|---|---|
| PubChem CID | 162359586 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-5-fluoro-4-methylpyridine;ethane |
| SMILES | CC.Cc1cc(OCC(F)F)ncc1F |
| InChI | InChI=1S/C8H8F3NO.C2H6/c1-5-2-8(12-3-6(5)9)13-4-7(10)11;1-2/h2-3,7H,4H2,1H3;1-2H3 |
| InChIKey | PYYWQBVSMUOMBC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |