C10H7F7O2 — CID 155575031
2,4-bis(2,2-difluoroethoxy)-1,3,5-trifluorobenzene (PubChem CID 155575031) has the molecular formula C10H7F7O2 and a molecular weight of 292.15 g/mol. Its IUPAC name is 2,4-bis(2,2-difluoroethoxy)-1,3,5-trifluorobenzene.
| Compound Name | 2,4-bis(2,2-difluoroethoxy)-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 155575031 |
| Molecular Formula | C10H7F7O2 |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2,4-bis(2,2-difluoroethoxy)-1,3,5-trifluorobenzene |
| SMILES | Fc1cc(F)c(OCC(F)F)c(F)c1OCC(F)F |
| InChI | InChI=1S/C10H7F7O2/c11-4-1-5(12)10(19-3-7(15)16)8(17)9(4)18-2-6(13)14/h1,6-7H,2-3H2 |
| InChIKey | SUIBRYSPYPSAQY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |