C11H10F4O2 — CID 174811184
1-[4-(2,2-difluoroethoxy)-3,5-difluorophenyl]propan-1-one (PubChem CID 174811184) has the molecular formula C11H10F4O2 and a molecular weight of 250.19 g/mol. Its IUPAC name is 1-[4-(2,2-difluoroethoxy)-3,5-difluorophenyl]propan-1-one.
| Compound Name | 1-[4-(2,2-difluoroethoxy)-3,5-difluorophenyl]propan-1-one |
|---|---|
| PubChem CID | 174811184 |
| Molecular Formula | C11H10F4O2 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1-[4-(2,2-difluoroethoxy)-3,5-difluorophenyl]propan-1-one |
| SMILES | CCC(=O)c1cc(F)c(OCC(F)F)c(F)c1 |
| InChI | InChI=1S/C11H10F4O2/c1-2-9(16)6-3-7(12)11(8(13)4-6)17-5-10(14)15/h3-4,10H,2,5H2,1H3 |
| InChIKey | HXBMLHHFOKJPMD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |