C15H19ClF2O4 — CID 163618896
1-[4-(3-chloropropoxy)-3,5-difluorophenyl]-4-ethoxy-4-hydroxybutan-1-one (PubChem CID 163618896) has the molecular formula C15H19ClF2O4 and a molecular weight of 336.76 g/mol. Its IUPAC name is 1-[4-(3-chloropropoxy)-3,5-difluorophenyl]-4-ethoxy-4-hydroxybutan-1-one.
| Compound Name | 1-[4-(3-chloropropoxy)-3,5-difluorophenyl]-4-ethoxy-4-hydroxybutan-1-one |
|---|---|
| PubChem CID | 163618896 |
| Molecular Formula | C15H19ClF2O4 |
| Molecular Weight | 336.76 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-[4-(3-chloropropoxy)-3,5-difluorophenyl]-4-ethoxy-4-hydroxybutan-1-one |
| SMILES | CCOC(O)CCC(=O)c1cc(F)c(OCCCCl)c(F)c1 |
| InChI | InChI=1S/C15H19ClF2O4/c1-2-21-14(20)5-4-13(19)10-8-11(17)15(12(18)9-10)22-7-3-6-16/h8-9,14,20H,2-7H2,1H3 |
| InChIKey | HMJRAIKXQJMCDT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|