C8H8BrF2NO — CID 163242204
3-bromo-5-(2,2-difluoroethoxy)-2-methylpyridine (PubChem CID 163242204) has the molecular formula C8H8BrF2NO and a molecular weight of 252.06 g/mol. Its IUPAC name is 3-bromo-5-(2,2-difluoroethoxy)-2-methylpyridine.
| Compound Name | 3-bromo-5-(2,2-difluoroethoxy)-2-methylpyridine |
|---|---|
| PubChem CID | 163242204 |
| Molecular Formula | C8H8BrF2NO |
| Molecular Weight | 252.06 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | 3-bromo-5-(2,2-difluoroethoxy)-2-methylpyridine |
| SMILES | Cc1ncc(OCC(F)F)cc1Br |
| InChI | InChI=1S/C8H8BrF2NO/c1-5-7(9)2-6(3-12-5)13-4-8(10)11/h2-3,8H,4H2,1H3 |
| InChIKey | QQZQCPJFWBAALS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.06 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |