C7H8BrF2N3O — CID 82009346
5-bromo-4-(2,2-difluoroethoxy)-N-methylpyrimidin-2-amine (PubChem CID 82009346) has the molecular formula C7H8BrF2N3O and a molecular weight of 268.06 g/mol. Its IUPAC name is 5-bromo-4-(2,2-difluoroethoxy)-N-methylpyrimidin-2-amine.
| Compound Name | 5-bromo-4-(2,2-difluoroethoxy)-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 82009346 |
| Molecular Formula | C7H8BrF2N3O |
| Molecular Weight | 268.06 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | 5-bromo-4-(2,2-difluoroethoxy)-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(Br)c(OCC(F)F)n1 |
| InChI | InChI=1S/C7H8BrF2N3O/c1-11-7-12-2-4(8)6(13-7)14-3-5(9)10/h2,5H,3H2,1H3,(H,11,12,13) |
| InChIKey | FRXNCJSQHRPPTP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.06 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |