C7H9BrF2N2O — CID 151256853
4-bromo-5-(2,2-difluoroethoxy)-1-ethylpyrazole (PubChem CID 151256853) has the molecular formula C7H9BrF2N2O and a molecular weight of 255.06 g/mol. Its IUPAC name is 4-bromo-5-(2,2-difluoroethoxy)-1-ethylpyrazole.
| Compound Name | 4-bromo-5-(2,2-difluoroethoxy)-1-ethylpyrazole |
|---|---|
| PubChem CID | 151256853 |
| Molecular Formula | C7H9BrF2N2O |
| Molecular Weight | 255.06 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 4-bromo-5-(2,2-difluoroethoxy)-1-ethylpyrazole |
| SMILES | CCn1ncc(Br)c1OCC(F)F |
| InChI | InChI=1S/C7H9BrF2N2O/c1-2-12-7(5(8)3-11-12)13-4-6(9)10/h3,6H,2,4H2,1H3 |
| InChIKey | NTMUCJNQHGJFGP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.06 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |